C18H14ClF3N2O4S — CID 87537823
4-[5-chloro-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoic acid (PubChem CID 87537823) has the molecular formula C18H14ClF3N2O4S and a molecular weight of 446.83 g/mol. Its IUPAC name is 4-[5-chloro-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoic acid.
| Compound Name | 4-[5-chloro-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 87537823 |
| Molecular Formula | C18H14ClF3N2O4S |
| Molecular Weight | 446.83 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 4-[5-chloro-1-[3-(trifluoromethyl)phenyl]sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cc2nc(Cl)ccc2n1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14ClF3N2O4S/c19-16-8-7-15-14(23-16)10-12(4-2-6-17(25)26)24(15)29(27,28)13-5-1-3-11(9-13)18(20,21)22/h1,3,5,7-10H,2,4,6H2,(H,25,26) |
| InChIKey | OHECRXKIAZGUDS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.83 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|