C20H21ClN2O4S — CID 87538442
4-[5-chloro-1-(3-propan-2-ylphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoic acid (PubChem CID 87538442) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is 4-[5-chloro-1-(3-propan-2-ylphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoic acid.
| Compound Name | 4-[5-chloro-1-(3-propan-2-ylphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 87538442 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 4-[5-chloro-1-(3-propan-2-ylphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoic acid |
| SMILES | CC(C)c1cccc(S(=O)(=O)n2c(CCCC(=O)O)cc3nc(Cl)ccc32)c1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-13(2)14-5-3-7-16(11-14)28(26,27)23-15(6-4-8-20(24)25)12-17-18(23)9-10-19(21)22-17/h3,5,7,9-13H,4,6,8H2,1-2H3,(H,24,25) |
| InChIKey | VIUYOQYSHLQYHN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|