C21H22ClNO4S — CID 44600159
4-[5-chloro-1-(3-propan-2-ylphenyl)sulfonylindol-2-yl]butanoic acid (PubChem CID 44600159) has the molecular formula C21H22ClNO4S and a molecular weight of 419.93 g/mol. Its IUPAC name is 4-[5-chloro-1-(3-propan-2-ylphenyl)sulfonylindol-2-yl]butanoic acid.
| Compound Name | 4-[5-chloro-1-(3-propan-2-ylphenyl)sulfonylindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 44600159 |
| Molecular Formula | C21H22ClNO4S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 4-[5-chloro-1-(3-propan-2-ylphenyl)sulfonylindol-2-yl]butanoic acid |
| SMILES | CC(C)c1cccc(S(=O)(=O)n2c(CCCC(=O)O)cc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C21H22ClNO4S/c1-14(2)15-5-3-7-19(13-15)28(26,27)23-18(6-4-8-21(24)25)12-16-11-17(22)9-10-20(16)23/h3,5,7,9-14H,4,6,8H2,1-2H3,(H,24,25) |
| InChIKey | QFFRWDKQDGTMAX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |