C18H15ClFNO4S — CID 68675545
methyl 3-[5-chloro-1-(4-fluorophenyl)sulfonylindol-2-yl]propanoate (PubChem CID 68675545) has the molecular formula C18H15ClFNO4S and a molecular weight of 395.84 g/mol. Its IUPAC name is methyl 3-[5-chloro-1-(4-fluorophenyl)sulfonylindol-2-yl]propanoate.
| Compound Name | methyl 3-[5-chloro-1-(4-fluorophenyl)sulfonylindol-2-yl]propanoate |
|---|---|
| PubChem CID | 68675545 |
| Molecular Formula | C18H15ClFNO4S |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | methyl 3-[5-chloro-1-(4-fluorophenyl)sulfonylindol-2-yl]propanoate |
| SMILES | COC(=O)CCc1cc2cc(Cl)ccc2n1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15ClFNO4S/c1-25-18(22)9-5-15-11-12-10-13(19)2-8-17(12)21(15)26(23,24)16-6-3-14(20)4-7-16/h2-4,6-8,10-11H,5,9H2,1H3 |
| InChIKey | WGLIKFJCQYSUHD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |