C19H16ClN2O4S2+ — CID 163845945
4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]butanoyloxidanium (PubChem CID 163845945) has the molecular formula C19H16ClN2O4S2+ and a molecular weight of 435.93 g/mol. Its IUPAC name is 4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]butanoyloxidanium.
| Compound Name | 4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]butanoyloxidanium |
|---|---|
| PubChem CID | 163845945 |
| Molecular Formula | C19H16ClN2O4S2+ |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]butanoyloxidanium |
| SMILES | O=C([OH2+])CCCc1cc2cc(Cl)ccc2n1S(=O)(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C19H15ClN2O4S2/c20-13-4-7-17-12(8-13)9-14(2-1-3-19(23)24)22(17)28(25,26)15-5-6-16-18(10-15)27-11-21-16/h4-11H,1-3H2,(H,23,24)/p+1 |
| InChIKey | OQDQIFQRNZIEEJ-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 91.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|