C19H15ClN2O4S2 — CID 146309115
4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid (PubChem CID 146309115) has the molecular formula C19H15ClN2O4S2 and a molecular weight of 440.96 g/mol. Its IUPAC name is 4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid.
| Compound Name | 4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid |
|---|---|
| PubChem CID | 146309115 |
| Molecular Formula | C19H15ClN2O4S2 |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 4-[1-(1,3-benzothiazol-6-ylsulfonyl)-5-chloroindol-2-yl]-2,2,3,3,4,4-hexadeuteriobutanoic acid |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])c1cc2cc(Cl)ccc2n1S(=O)(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C19H15ClN2O4S2/c20-13-4-7-17-12(8-13)9-14(2-1-3-19(23)24)22(17)28(25,26)15-5-6-16-18(10-15)27-11-21-16/h4-11H,1-3H2,(H,23,24)/i1D2,2D2,3D2 |
| InChIKey | OQDQIFQRNZIEEJ-NMFSSPJFSA-N |
| XLogP | 4.55 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |