C19H19ClN2O6S — CID 87538349
2-[[5-chloro-1-(4-methoxyphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]methoxy]-2-methylpropanoic acid (PubChem CID 87538349) has the molecular formula C19H19ClN2O6S and a molecular weight of 438.89 g/mol. Its IUPAC name is 2-[[5-chloro-1-(4-methoxyphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]methoxy]-2-methylpropanoic acid.
| Compound Name | 2-[[5-chloro-1-(4-methoxyphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]methoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87538349 |
| Molecular Formula | C19H19ClN2O6S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 2-[[5-chloro-1-(4-methoxyphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]methoxy]-2-methylpropanoic acid |
| SMILES | COc1ccc(S(=O)(=O)n2c(COC(C)(C)C(=O)O)cc3nc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C19H19ClN2O6S/c1-19(2,18(23)24)28-11-12-10-15-16(8-9-17(20)21-15)22(12)29(25,26)14-6-4-13(27-3)5-7-14/h4-10H,11H2,1-3H3,(H,23,24) |
| InChIKey | BXWJOUHIEIVWOS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|