C18H15Cl3N2O5S — CID 87538725
2-[[5-chloro-1-(2,3-dichlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]methoxy]-2-methylpropanoic acid (PubChem CID 87538725) has the molecular formula C18H15Cl3N2O5S and a molecular weight of 477.75 g/mol. Its IUPAC name is 2-[[5-chloro-1-(2,3-dichlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]methoxy]-2-methylpropanoic acid.
| Compound Name | 2-[[5-chloro-1-(2,3-dichlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]methoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87538725 |
| Molecular Formula | C18H15Cl3N2O5S |
| Molecular Weight | 477.75 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | 2-[[5-chloro-1-(2,3-dichlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]methoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(OCc1cc2nc(Cl)ccc2n1S(=O)(=O)c1cccc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C18H15Cl3N2O5S/c1-18(2,17(24)25)28-9-10-8-12-13(6-7-15(20)22-12)23(10)29(26,27)14-5-3-4-11(19)16(14)21/h3-8H,9H2,1-2H3,(H,24,25) |
| InChIKey | ZXKCQJZXQUCTGN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|