C22H24ClN3O4S — CID 142783940
methyl 4-[5-chloro-1-(4-pyrrolidin-1-ylphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate (PubChem CID 142783940) has the molecular formula C22H24ClN3O4S and a molecular weight of 461.97 g/mol. Its IUPAC name is methyl 4-[5-chloro-1-(4-pyrrolidin-1-ylphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate.
| Compound Name | methyl 4-[5-chloro-1-(4-pyrrolidin-1-ylphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate |
|---|---|
| PubChem CID | 142783940 |
| Molecular Formula | C22H24ClN3O4S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | methyl 4-[5-chloro-1-(4-pyrrolidin-1-ylphenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate |
| SMILES | COC(=O)CCCc1cc2nc(Cl)ccc2n1S(=O)(=O)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C22H24ClN3O4S/c1-30-22(27)6-4-5-17-15-19-20(11-12-21(23)24-19)26(17)31(28,29)18-9-7-16(8-10-18)25-13-2-3-14-25/h7-12,15H,2-6,13-14H2,1H3 |
| InChIKey | ZMOZOBSBNIKBFC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|