C17H14Cl2N4O4S2 — CID 142783950
methyl 4-[5-chloro-1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate (PubChem CID 142783950) has the molecular formula C17H14Cl2N4O4S2 and a molecular weight of 473.36 g/mol. Its IUPAC name is methyl 4-[5-chloro-1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate.
| Compound Name | methyl 4-[5-chloro-1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate |
|---|---|
| PubChem CID | 142783950 |
| Molecular Formula | C17H14Cl2N4O4S2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | methyl 4-[5-chloro-1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate |
| SMILES | COC(=O)CCCc1cc2nc(Cl)ccc2n1S(=O)(=O)c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C17H14Cl2N4O4S2/c1-27-14(24)4-2-3-10-9-11-12(5-6-13(18)20-11)23(10)29(25,26)16-15(19)21-17-22(16)7-8-28-17/h5-9H,2-4H2,1H3 |
| InChIKey | KVMZNMJKJONIIV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|