C8H10ClN3O4S2 — CID 114009664
6-chloro-N-(2-methoxyethoxy)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 114009664) has the molecular formula C8H10ClN3O4S2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 6-chloro-N-(2-methoxyethoxy)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-(2-methoxyethoxy)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 114009664 |
| Molecular Formula | C8H10ClN3O4S2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 6-chloro-N-(2-methoxyethoxy)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | COCCONS(=O)(=O)c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C8H10ClN3O4S2/c1-15-3-4-16-11-18(13,14)7-6(9)10-8-12(7)2-5-17-8/h2,5,11H,3-4H2,1H3 |
| InChIKey | KRGODXSPNKSRDE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|