C10H15ClN4O2S2 — CID 60812798
6-chloro-N-[3-(dimethylamino)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 60812798) has the molecular formula C10H15ClN4O2S2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 6-chloro-N-[3-(dimethylamino)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-[3-(dimethylamino)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 60812798 |
| Molecular Formula | C10H15ClN4O2S2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 6-chloro-N-[3-(dimethylamino)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C10H15ClN4O2S2/c1-14(2)5-3-4-12-19(16,17)9-8(11)13-10-15(9)6-7-18-10/h6-7,12H,3-5H2,1-2H3 |
| InChIKey | OXSHZFGHRRDMPG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|