C11H16ClN3O4S2 — CID 61247733
6-chloro-N-[3-(2-methoxyethoxy)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 61247733) has the molecular formula C11H16ClN3O4S2 and a molecular weight of 353.85 g/mol. Its IUPAC name is 6-chloro-N-[3-(2-methoxyethoxy)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-[3-(2-methoxyethoxy)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61247733 |
| Molecular Formula | C11H16ClN3O4S2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 6-chloro-N-[3-(2-methoxyethoxy)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | COCCOCCCNS(=O)(=O)c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C11H16ClN3O4S2/c1-18-6-7-19-5-2-3-13-21(16,17)10-9(12)14-11-15(10)4-8-20-11/h4,8,13H,2-3,5-7H2,1H3 |
| InChIKey | HIJUMWDJGSBFSB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|