C10H11ClN6O2S2 — CID 64531115
6-chloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 64531115) has the molecular formula C10H11ClN6O2S2 and a molecular weight of 346.83 g/mol. Its IUPAC name is 6-chloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 64531115 |
| Molecular Formula | C10H11ClN6O2S2 |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 6-chloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCCc1ncn[nH]1)c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C10H11ClN6O2S2/c11-8-9(17-4-5-20-10(17)15-8)21(18,19)14-3-1-2-7-12-6-13-16-7/h4-6,14H,1-3H2,(H,12,13,16) |
| InChIKey | VTPQHJSBCSADDJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|