C12H21N5O2S2 — CID 62158615
N-[4-(dimethylamino)butyl]-6-(methylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 62158615) has the molecular formula C12H21N5O2S2 and a molecular weight of 331.47 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-6-(methylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | N-[4-(dimethylamino)butyl]-6-(methylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 62158615 |
| Molecular Formula | C12H21N5O2S2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-6-(methylamino)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CNc1nc2sccn2c1S(=O)(=O)NCCCCN(C)C |
| InChI | InChI=1S/C12H21N5O2S2/c1-13-10-11(17-8-9-20-12(17)15-10)21(18,19)14-6-4-5-7-16(2)3/h8-9,13-14H,4-7H2,1-3H3 |
| InChIKey | LHJXNINJMYCYFN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|