C10H16N4O2S3 — CID 63962711
6-(methylamino)-N-(3-methylsulfanylpropyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 63962711) has the molecular formula C10H16N4O2S3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 6-(methylamino)-N-(3-methylsulfanylpropyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-(methylamino)-N-(3-methylsulfanylpropyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63962711 |
| Molecular Formula | C10H16N4O2S3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 6-(methylamino)-N-(3-methylsulfanylpropyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CNc1nc2sccn2c1S(=O)(=O)NCCCSC |
| InChI | InChI=1S/C10H16N4O2S3/c1-11-8-9(14-5-7-18-10(14)13-8)19(15,16)12-4-3-6-17-2/h5,7,11-12H,3-4,6H2,1-2H3 |
| InChIKey | DCHJZAUGSJRFJT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|