C12H18N4O2S2 — CID 63961435
2-(methylamino)-N-(3-methylsulfanylpropyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 63961435) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-(methylamino)-N-(3-methylsulfanylpropyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-(methylamino)-N-(3-methylsulfanylpropyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63961435 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(methylamino)-N-(3-methylsulfanylpropyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CNc1nc2ccccn2c1S(=O)(=O)NCCCSC |
| InChI | InChI=1S/C12H18N4O2S2/c1-13-11-12(16-8-4-3-6-10(16)15-11)20(17,18)14-7-5-9-19-2/h3-4,6,8,13-14H,5,7,9H2,1-2H3 |
| InChIKey | BQDQVLIVPLORFQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|