C11H16N4O2S — CID 62150171
2-(methylamino)-N-propylimidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 62150171) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-(methylamino)-N-propylimidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-(methylamino)-N-propylimidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62150171 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-(methylamino)-N-propylimidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CCCNS(=O)(=O)c1c(NC)nc2ccccn12 |
| InChI | InChI=1S/C11H16N4O2S/c1-3-7-13-18(16,17)11-10(12-2)14-9-6-4-5-8-15(9)11/h4-6,8,12-13H,3,7H2,1-2H3 |
| InChIKey | LKJJSZQFCQEQPW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |