About 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide
2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 62143002) has the molecular formula C10H14N4O2S
and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide |
| PubChem CID | 62143002 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CCCNc1nc2ccccn2c1S(N)(=O)=O |
| InChI | InChI=1S/C10H14N4O2S/c1-2-6-12-9-10(17(11,15)16)14-7-4-3-5-8(14)13-9/h3-5,7,12H,2,6H2,1H3,(H2,11,15,16) |
| InChIKey | LBWGVGNQFZNYMG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide?
The IUPAC name of 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide (CID 62143002) is 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide.
What is the SMILES notation for 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide?
The canonical SMILES for 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide is CCCNc1nc2ccccn2c1S(N)(=O)=O.
What is the InChIKey of 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide?
The InChIKey is LBWGVGNQFZNYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O2S/c1-2-6-12-9-10(17(11,15)16)14-7-4-3-5-8(14)13-9/h3-5,7,12H,2,6H2,1H3,(H2,11,15,16).
What are the key properties of 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide?
2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide has a molecular weight of 254.31 g/mol, XLogP of 0.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylamino)imidazo[1,2-a]pyridine-3-sulfonamide is sourced from PubChem (CID 62143002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).