C11H17N5O3S — CID 114230312
2-hydrazinyl-N-(3-hydroxypropyl)-N-methylimidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 114230312) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-hydrazinyl-N-(3-hydroxypropyl)-N-methylimidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-hydrazinyl-N-(3-hydroxypropyl)-N-methylimidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114230312 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-hydrazinyl-N-(3-hydroxypropyl)-N-methylimidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CN(CCCO)S(=O)(=O)c1c(NN)nc2ccccn12 |
| InChI | InChI=1S/C11H17N5O3S/c1-15(6-4-8-17)20(18,19)11-10(14-12)13-9-5-2-3-7-16(9)11/h2-3,5,7,14,17H,4,6,8,12H2,1H3 |
| InChIKey | XRZIKZQFCSBQAZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|