C11H17N5O2S2 — CID 115986127
2-hydrazinyl-N-methyl-N-(2-methylsulfanylethyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 115986127) has the molecular formula C11H17N5O2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-hydrazinyl-N-methyl-N-(2-methylsulfanylethyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-hydrazinyl-N-methyl-N-(2-methylsulfanylethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115986127 |
| Molecular Formula | C11H17N5O2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-hydrazinyl-N-methyl-N-(2-methylsulfanylethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1c(NN)nc2ccccn12 |
| InChI | InChI=1S/C11H17N5O2S2/c1-15(7-8-19-2)20(17,18)11-10(14-12)13-9-5-3-4-6-16(9)11/h3-6,14H,7-8,12H2,1-2H3 |
| InChIKey | PDDMPOLXCNUPCV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|