C11H15N5O4S — CID 106670070
1-(2-hydrazinylimidazo[1,2-a]pyridin-3-yl)sulfonylpyrrolidine-3,4-diol (PubChem CID 106670070) has the molecular formula C11H15N5O4S and a molecular weight of 313.34 g/mol. Its IUPAC name is 1-(2-hydrazinylimidazo[1,2-a]pyridin-3-yl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | 1-(2-hydrazinylimidazo[1,2-a]pyridin-3-yl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670070 |
| Molecular Formula | C11H15N5O4S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-(2-hydrazinylimidazo[1,2-a]pyridin-3-yl)sulfonylpyrrolidine-3,4-diol |
| SMILES | NNc1nc2ccccn2c1S(=O)(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H15N5O4S/c12-14-10-11(16-4-2-1-3-9(16)13-10)21(19,20)15-5-7(17)8(18)6-15/h1-4,7-8,14,17-18H,5-6,12H2 |
| InChIKey | LVWNDTCQVCNIAF-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|