C9H14N4O4S — CID 106670062
1-[(2-hydrazinyl-3-pyridinyl)sulfonyl]pyrrolidine-3,4-diol (PubChem CID 106670062) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-[(2-hydrazinyl-3-pyridinyl)sulfonyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(2-hydrazinyl-3-pyridinyl)sulfonyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670062 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-[(2-hydrazinyl-3-pyridinyl)sulfonyl]pyrrolidine-3,4-diol |
| SMILES | NNc1ncccc1S(=O)(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C9H14N4O4S/c10-12-9-8(2-1-3-11-9)18(16,17)13-4-6(14)7(15)5-13/h1-3,6-7,14-15H,4-5,10H2,(H,11,12) |
| InChIKey | RHXFPOGXSCZIMJ-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|