C9H13N3O4S — CID 107213209
(3R,4S)-1-[(2-amino-3-pyridinyl)sulfonyl]pyrrolidine-3,4-diol (PubChem CID 107213209) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is (3R,4S)-1-[(2-amino-3-pyridinyl)sulfonyl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[(2-amino-3-pyridinyl)sulfonyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 107213209 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (3R,4S)-1-[(2-amino-3-pyridinyl)sulfonyl]pyrrolidine-3,4-diol |
| SMILES | Nc1ncccc1S(=O)(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C9H13N3O4S/c10-9-8(2-1-3-11-9)17(15,16)12-4-6(13)7(14)5-12/h1-3,6-7,13-14H,4-5H2,(H2,10,11)/t6-,7+ |
| InChIKey | WQPRFLMWMKKYJR-KNVOCYPGSA-N |
| XLogP | -1.61 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |