C11H15N5O4S — CID 83206171
2-[[2-(methylamino)imidazo[1,2-a]pyridin-3-yl]sulfonylamino]ethyl carbamate (PubChem CID 83206171) has the molecular formula C11H15N5O4S and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[[2-(methylamino)imidazo[1,2-a]pyridin-3-yl]sulfonylamino]ethyl carbamate.
| Compound Name | 2-[[2-(methylamino)imidazo[1,2-a]pyridin-3-yl]sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83206171 |
| Molecular Formula | C11H15N5O4S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[[2-(methylamino)imidazo[1,2-a]pyridin-3-yl]sulfonylamino]ethyl carbamate |
| SMILES | CNc1nc2ccccn2c1S(=O)(=O)NCCOC(N)=O |
| InChI | InChI=1S/C11H15N5O4S/c1-13-9-10(16-6-3-2-4-8(16)15-9)21(18,19)14-5-7-20-11(12)17/h2-4,6,13-14H,5,7H2,1H3,(H2,12,17) |
| InChIKey | BZPVAYOLSHMRNK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|