C12H18N4O3S — CID 104765403
2-amino-N-(2-propan-2-yloxyethyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 104765403) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-amino-N-(2-propan-2-yloxyethyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-(2-propan-2-yloxyethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 104765403 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-amino-N-(2-propan-2-yloxyethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CC(C)OCCNS(=O)(=O)c1c(N)nc2ccccn12 |
| InChI | InChI=1S/C12H18N4O3S/c1-9(2)19-8-6-14-20(17,18)12-11(13)15-10-5-3-4-7-16(10)12/h3-5,7,9,14H,6,8,13H2,1-2H3 |
| InChIKey | DVXOTWUIYHMPIP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|