C10H11F3N4O2S2 — CID 106432805
2-amino-N-[2-(trifluoromethylsulfanyl)ethyl]imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 106432805) has the molecular formula C10H11F3N4O2S2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-amino-N-[2-(trifluoromethylsulfanyl)ethyl]imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-[2-(trifluoromethylsulfanyl)ethyl]imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106432805 |
| Molecular Formula | C10H11F3N4O2S2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-amino-N-[2-(trifluoromethylsulfanyl)ethyl]imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | Nc1nc2ccccn2c1S(=O)(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C10H11F3N4O2S2/c11-10(12,13)20-6-4-15-21(18,19)9-8(14)16-7-3-1-2-5-17(7)9/h1-3,5,15H,4,6,14H2 |
| InChIKey | KPSZJECCRIRRJQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|