C13H18N4O2S — CID 62148474
N-cyclopentyl-2-(methylamino)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 62148474) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-cyclopentyl-2-(methylamino)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | N-cyclopentyl-2-(methylamino)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62148474 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-cyclopentyl-2-(methylamino)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CNc1nc2ccccn2c1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C13H18N4O2S/c1-14-12-13(17-9-5-4-8-11(17)15-12)20(18,19)16-10-6-2-3-7-10/h4-5,8-10,14,16H,2-3,6-7H2,1H3 |
| InChIKey | IUCQPPZZTCUUOP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |