C10H15N5O3S2 — CID 62148100
4-[[6-(methylamino)imidazo[2,1-b][1,3]thiazol-5-yl]sulfonylamino]butanamide (PubChem CID 62148100) has the molecular formula C10H15N5O3S2 and a molecular weight of 317.40 g/mol. Its IUPAC name is 4-[[6-(methylamino)imidazo[2,1-b][1,3]thiazol-5-yl]sulfonylamino]butanamide.
| Compound Name | 4-[[6-(methylamino)imidazo[2,1-b][1,3]thiazol-5-yl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 62148100 |
| Molecular Formula | C10H15N5O3S2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-[[6-(methylamino)imidazo[2,1-b][1,3]thiazol-5-yl]sulfonylamino]butanamide |
| SMILES | CNc1nc2sccn2c1S(=O)(=O)NCCCC(N)=O |
| InChI | InChI=1S/C10H15N5O3S2/c1-12-8-9(15-5-6-19-10(15)14-8)20(17,18)13-4-2-3-7(11)16/h5-6,12-13H,2-4H2,1H3,(H2,11,16) |
| InChIKey | PUSXTEQGJPNBHO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|