C9H14N6O3S2 — CID 60812994
N-[2-[(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]ethyl]acetamide (PubChem CID 60812994) has the molecular formula C9H14N6O3S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[2-[(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 60812994 |
| Molecular Formula | C9H14N6O3S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-[2-[(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1c(NN)nc2sccn12 |
| InChI | InChI=1S/C9H14N6O3S2/c1-6(16)11-2-3-12-20(17,18)8-7(14-10)13-9-15(8)4-5-19-9/h4-5,12,14H,2-3,10H2,1H3,(H,11,16) |
| InChIKey | BDYHKXKKEPHDJF-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 130.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|