C10H15N5O2S3 — CID 107296956
6-hydrazinyl-N-(thiolan-3-ylmethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 107296956) has the molecular formula C10H15N5O2S3 and a molecular weight of 333.46 g/mol. Its IUPAC name is 6-hydrazinyl-N-(thiolan-3-ylmethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-hydrazinyl-N-(thiolan-3-ylmethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 107296956 |
| Molecular Formula | C10H15N5O2S3 |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 6-hydrazinyl-N-(thiolan-3-ylmethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)NCC1CCSC1 |
| InChI | InChI=1S/C10H15N5O2S3/c11-14-8-9(15-2-4-19-10(15)13-8)20(16,17)12-5-7-1-3-18-6-7/h2,4,7,12,14H,1,3,5-6,11H2 |
| InChIKey | BYOFBEJBNVSGSV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|