C10H15N5O3S2 — CID 115965507
[1-(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpyrrolidin-3-yl]methanol (PubChem CID 115965507) has the molecular formula C10H15N5O3S2 and a molecular weight of 317.40 g/mol. Its IUPAC name is [1-(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpyrrolidin-3-yl]methanol.
| Compound Name | [1-(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 115965507 |
| Molecular Formula | C10H15N5O3S2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | [1-(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpyrrolidin-3-yl]methanol |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)N1CCC(CO)C1 |
| InChI | InChI=1S/C10H15N5O3S2/c11-13-8-9(15-3-4-19-10(15)12-8)20(17,18)14-2-1-7(5-14)6-16/h3-4,7,13,16H,1-2,5-6,11H2 |
| InChIKey | CHRCDJSBQUZJDI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|