C11H15N5O3S2 — CID 66370094
[5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)imidazo[2,1-b][1,3]thiazol-6-yl]hydrazine (PubChem CID 66370094) has the molecular formula C11H15N5O3S2 and a molecular weight of 329.41 g/mol. Its IUPAC name is [5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)imidazo[2,1-b][1,3]thiazol-6-yl]hydrazine.
| Compound Name | [5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)imidazo[2,1-b][1,3]thiazol-6-yl]hydrazine |
|---|---|
| PubChem CID | 66370094 |
| Molecular Formula | C11H15N5O3S2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | [5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)imidazo[2,1-b][1,3]thiazol-6-yl]hydrazine |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C11H15N5O3S2/c12-14-9-10(16-3-4-20-11(16)13-9)21(17,18)15-5-7-1-2-8(6-15)19-7/h3-4,7-8,14H,1-2,5-6,12H2 |
| InChIKey | ZXCCQDBWKKFSEY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|