C11H15N5O3S2 — CID 80714351
6-hydrazinyl-N-(7-oxabicyclo[2.2.1]heptan-2-yl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 80714351) has the molecular formula C11H15N5O3S2 and a molecular weight of 329.41 g/mol. Its IUPAC name is 6-hydrazinyl-N-(7-oxabicyclo[2.2.1]heptan-2-yl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-hydrazinyl-N-(7-oxabicyclo[2.2.1]heptan-2-yl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 80714351 |
| Molecular Formula | C11H15N5O3S2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 6-hydrazinyl-N-(7-oxabicyclo[2.2.1]heptan-2-yl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)NC1CC2CCC1O2 |
| InChI | InChI=1S/C11H15N5O3S2/c12-14-9-10(16-3-4-20-11(16)13-9)21(17,18)15-7-5-6-1-2-8(7)19-6/h3-4,6-8,14-15H,1-2,5,12H2 |
| InChIKey | RQVGZPWVSFAYIE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|