C12H19N5O2S2 — CID 60814489
N-cyclohexyl-6-hydrazinyl-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 60814489) has the molecular formula C12H19N5O2S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is N-cyclohexyl-6-hydrazinyl-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | N-cyclohexyl-6-hydrazinyl-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 60814489 |
| Molecular Formula | C12H19N5O2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N-cyclohexyl-6-hydrazinyl-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1c(NN)nc2sccn12 |
| InChI | InChI=1S/C12H19N5O2S2/c1-16(9-5-3-2-4-6-9)21(18,19)11-10(15-13)14-12-17(11)7-8-20-12/h7-9,15H,2-6,13H2,1H3 |
| InChIKey | FCEHEOIGJFBANE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|