About [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine
[5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine (PubChem CID 61421703) has the molecular formula C12H19N5O2S2
and a molecular weight of 329.45 g/mol. Its IUPAC name is [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine.
Molecular Properties
| Compound Name | [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine |
| PubChem CID | 61421703 |
| Molecular Formula | C12H19N5O2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine |
| SMILES | CCC1CCN(S(=O)(=O)c2c(NN)nc3sccn23)CC1 |
| InChI | InChI=1S/C12H19N5O2S2/c1-2-9-3-5-16(6-4-9)21(18,19)11-10(15-13)14-12-17(11)7-8-20-12/h7-9,15H,2-6,13H2,1H3 |
| InChIKey | OVGNHYUEIZEFOQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine?
The IUPAC name of [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine (CID 61421703) is [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine.
What is the SMILES notation for [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine?
The canonical SMILES for [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine is CCC1CCN(S(=O)(=O)c2c(NN)nc3sccn23)CC1.
What is the InChIKey of [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine?
The InChIKey is OVGNHYUEIZEFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5O2S2/c1-2-9-3-5-16(6-4-9)21(18,19)11-10(15-13)14-12-17(11)7-8-20-12/h7-9,15H,2-6,13H2,1H3.
What are the key properties of [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine?
[5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine has a molecular weight of 329.45 g/mol, XLogP of 1.49, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-ethylpiperidin-1-yl)sulfonylimidazo[2,1-b][1,3]thiazol-6-yl]hydrazine is sourced from PubChem (CID 61421703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).