C7H12N6O4S3 — CID 60812992
6-hydrazinyl-N-(2-sulfamoylethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 60812992) has the molecular formula C7H12N6O4S3 and a molecular weight of 340.41 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-sulfamoylethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-hydrazinyl-N-(2-sulfamoylethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 60812992 |
| Molecular Formula | C7H12N6O4S3 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 6-hydrazinyl-N-(2-sulfamoylethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C7H12N6O4S3/c8-12-5-6(13-2-3-18-7(13)11-5)20(16,17)10-1-4-19(9,14)15/h2-3,10,12H,1,4,8H2,(H2,9,14,15) |
| InChIKey | BMSOKOVQZFZNBF-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|