C9H12N8O2S2 — CID 64531201
6-hydrazinyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 64531201) has the molecular formula C9H12N8O2S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-hydrazinyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 64531201 |
| Molecular Formula | C9H12N8O2S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 6-hydrazinyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C9H12N8O2S2/c10-15-7-8(17-3-4-20-9(17)14-7)21(18,19)13-2-1-6-11-5-12-16-6/h3-5,13,15H,1-2,10H2,(H,11,12,16) |
| InChIKey | CRHLCQGNRNNPND-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 143.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|