C9H10N6O3S2 — CID 106419550
6-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 106419550) has the molecular formula C9H10N6O3S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 106419550 |
| Molecular Formula | C9H10N6O3S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 6-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)NCc1ccno1 |
| InChI | InChI=1S/C9H10N6O3S2/c10-14-7-8(15-3-4-19-9(15)13-7)20(16,17)12-5-6-1-2-11-18-6/h1-4,12,14H,5,10H2 |
| InChIKey | MREPODWHPNWVAK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 127.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|