C7H10N6O3S2 — CID 60813647
2-[(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]acetamide (PubChem CID 60813647) has the molecular formula C7H10N6O3S2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]acetamide.
| Compound Name | 2-[(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 60813647 |
| Molecular Formula | C7H10N6O3S2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-[(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]acetamide |
| SMILES | NNc1nc2sccn2c1S(=O)(=O)NCC(N)=O |
| InChI | InChI=1S/C7H10N6O3S2/c8-4(14)3-10-18(15,16)6-5(12-9)11-7-13(6)1-2-17-7/h1-2,10,12H,3,9H2,(H2,8,14) |
| InChIKey | SGWQIYXSPXJSLI-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 144.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|