C10H13N7O2S2 — CID 63293514
6-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 63293514) has the molecular formula C10H13N7O2S2 and a molecular weight of 327.40 g/mol. Its IUPAC name is 6-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63293514 |
| Molecular Formula | C10H13N7O2S2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 6-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | Cn1ccnc1CNS(=O)(=O)c1c(NN)nc2sccn12 |
| InChI | InChI=1S/C10H13N7O2S2/c1-16-3-2-12-7(16)6-13-21(18,19)9-8(15-11)14-10-17(9)4-5-20-10/h2-5,13,15H,6,11H2,1H3 |
| InChIKey | GOEPPJQLEAWGCQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|