C10H14N4O3S2 — CID 62153628
1-(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpiperidin-3-ol (PubChem CID 62153628) has the molecular formula C10H14N4O3S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpiperidin-3-ol.
| Compound Name | 1-(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 62153628 |
| Molecular Formula | C10H14N4O3S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylpiperidin-3-ol |
| SMILES | Nc1nc2sccn2c1S(=O)(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C10H14N4O3S2/c11-8-9(14-4-5-18-10(14)12-8)19(16,17)13-3-1-2-7(15)6-13/h4-5,7,15H,1-3,6,11H2 |
| InChIKey | RYSQHZOBYINUQZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |