C10H14N4O2S2 — CID 62143175
5-piperidin-1-ylsulfonylimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 62143175) has the molecular formula C10H14N4O2S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-piperidin-1-ylsulfonylimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-piperidin-1-ylsulfonylimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 62143175 |
| Molecular Formula | C10H14N4O2S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 5-piperidin-1-ylsulfonylimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | Nc1nc2sccn2c1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C10H14N4O2S2/c11-8-9(14-6-7-17-10(14)12-8)18(15,16)13-4-2-1-3-5-13/h6-7H,1-5,11H2 |
| InChIKey | JRGWEDIVQKJMTD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |