C7H8ClN3O3S2 — CID 61052679
6-chloro-N-methoxy-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 61052679) has the molecular formula C7H8ClN3O3S2 and a molecular weight of 281.75 g/mol. Its IUPAC name is 6-chloro-N-methoxy-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-methoxy-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61052679 |
| Molecular Formula | C7H8ClN3O3S2 |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 6-chloro-N-methoxy-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CON(C)S(=O)(=O)c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C7H8ClN3O3S2/c1-10(14-2)16(12,13)6-5(8)9-7-11(6)3-4-15-7/h3-4H,1-2H3 |
| InChIKey | YZRKLYQWOVVRBO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|