C11H8ClN3O3S2 — CID 103739497
6-chloro-N-(2-hydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 103739497) has the molecular formula C11H8ClN3O3S2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 6-chloro-N-(2-hydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-(2-hydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103739497 |
| Molecular Formula | C11H8ClN3O3S2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 6-chloro-N-(2-hydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1O)c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C11H8ClN3O3S2/c12-9-10(15-5-6-19-11(15)13-9)20(17,18)14-7-3-1-2-4-8(7)16/h1-6,14,16H |
| InChIKey | ADTNYZWWROSKGR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|