C13H8ClN3O2S2 — CID 60814471
6-chloro-N-(3-ethynylphenyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 60814471) has the molecular formula C13H8ClN3O2S2 and a molecular weight of 337.81 g/mol. Its IUPAC name is 6-chloro-N-(3-ethynylphenyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-(3-ethynylphenyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 60814471 |
| Molecular Formula | C13H8ClN3O2S2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 6-chloro-N-(3-ethynylphenyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | C#Cc1cccc(NS(=O)(=O)c2c(Cl)nc3sccn23)c1 |
| InChI | InChI=1S/C13H8ClN3O2S2/c1-2-9-4-3-5-10(8-9)16-21(18,19)12-11(14)15-13-17(12)6-7-20-13/h1,3-8,16H |
| InChIKey | WMRJWOSYLHGHQO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|