C15H11N3OS — CID 47151104
7-[(3-ethynylanilino)methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 47151104) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 7-[(3-ethynylanilino)methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[(3-ethynylanilino)methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 47151104 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 7-[(3-ethynylanilino)methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | C#Cc1cccc(NCc2cc(=O)n3ccsc3n2)c1 |
| InChI | InChI=1S/C15H11N3OS/c1-2-11-4-3-5-12(8-11)16-10-13-9-14(19)18-6-7-20-15(18)17-13/h1,3-9,16H,10H2 |
| InChIKey | AHLQCSWDAJGGEL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|