C15H13N3OS — CID 43755492
3-ethynyl-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline (PubChem CID 43755492) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 3-ethynyl-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline.
| Compound Name | 3-ethynyl-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 43755492 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-ethynyl-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline |
| SMILES | C#Cc1cccc(NCc2c(OC)nc3sccn23)c1 |
| InChI | InChI=1S/C15H13N3OS/c1-3-11-5-4-6-12(9-11)16-10-13-14(19-2)17-15-18(13)7-8-20-15/h1,4-9,16H,10H2,2H3 |
| InChIKey | TZSHTPVMVDFLJV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|