C13H12IN3S — CID 43773324
3-iodo-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline (PubChem CID 43773324) has the molecular formula C13H12IN3S and a molecular weight of 369.23 g/mol. Its IUPAC name is 3-iodo-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline.
| Compound Name | 3-iodo-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 43773324 |
| Molecular Formula | C13H12IN3S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 3-iodo-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline |
| SMILES | Cc1nc2sccn2c1CNc1cccc(I)c1 |
| InChI | InChI=1S/C13H12IN3S/c1-9-12(17-5-6-18-13(17)16-9)8-15-11-4-2-3-10(14)7-11/h2-7,15H,8H2,1H3 |
| InChIKey | SKBVMUYFENEPLM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|