C12H11ClN4S — CID 43782424
2-chloro-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]pyridin-3-amine (PubChem CID 43782424) has the molecular formula C12H11ClN4S and a molecular weight of 278.77 g/mol. Its IUPAC name is 2-chloro-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]pyridin-3-amine.
| Compound Name | 2-chloro-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 43782424 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-chloro-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]pyridin-3-amine |
| SMILES | Cc1nc2sccn2c1CNc1cccnc1Cl |
| InChI | InChI=1S/C12H11ClN4S/c1-8-10(17-5-6-18-12(17)16-8)7-15-9-3-2-4-14-11(9)13/h2-6,15H,7H2,1H3 |
| InChIKey | KGOZJIYSEDWFKR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|